About methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate
methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate (PubChem CID 138584566) has the molecular formula C10H7F3N2O3
and a molecular weight of 260.17 g/mol. Its IUPAC name is methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate.
Analyze methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate?
The IUPAC name of methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate (CID 138584566) is methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate.
What is the SMILES notation for methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate?
The canonical SMILES for methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate is COC(=O)c1cc(C#N)cc(OCC(F)(F)F)n1.
What is the InChIKey of methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate?
The InChIKey is GBUIOISEOQJSFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N2O3/c1-17-9(16)7-2-6(4-14)3-8(15-7)18-5-10(11,12)13/h2-3H,5H2,1H3.
What are the key properties of methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate?
methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate has a molecular weight of 260.17 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-cyano-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylate is sourced from PubChem (CID 138584566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).