About methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate
methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate (PubChem CID 138585058) has the molecular formula C9H9F2NO3
and a molecular weight of 217.17 g/mol. Its IUPAC name is methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate |
| PubChem CID | 138585058 |
| Molecular Formula | C9H9F2NO3 |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(O)cc1C(C)(F)F |
| InChI | InChI=1S/C9H9F2NO3/c1-9(10,11)6-3-5(13)4-12-7(6)8(14)15-2/h3-4,13H,1-2H3 |
| InChIKey | YEAVXFIGSACMNU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate?
The IUPAC name of methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate (CID 138585058) is methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate.
What is the SMILES notation for methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate?
The canonical SMILES for methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate is COC(=O)c1ncc(O)cc1C(C)(F)F.
What is the InChIKey of methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate?
The InChIKey is YEAVXFIGSACMNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO3/c1-9(10,11)6-3-5(13)4-12-7(6)8(14)15-2/h3-4,13H,1-2H3.
What are the key properties of methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate?
methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate has a molecular weight of 217.17 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1,1-difluoroethyl)-5-hydroxypyridine-2-carboxylate is sourced from PubChem (CID 138585058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).