About 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid
5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid (PubChem CID 138585092) has the molecular formula C9H7F3N2O3
and a molecular weight of 248.16 g/mol. Its IUPAC name is 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid.
Molecular Properties
| Compound Name | 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid |
| PubChem CID | 138585092 |
| Molecular Formula | C9H7F3N2O3 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid |
| SMILES | N/C(=N\O)c1ccc(C(F)(F)F)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H7F3N2O3/c10-9(11,12)6-2-1-4(7(13)14-17)3-5(6)8(15)16/h1-3,17H,(H2,13,14)(H,15,16) |
| InChIKey | FNXAIVCZUNVAAR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid?
The IUPAC name of 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid (CID 138585092) is 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid.
What is the SMILES notation for 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid?
The canonical SMILES for 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid is N/C(=N\O)c1ccc(C(F)(F)F)c(C(=O)O)c1.
What is the InChIKey of 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid?
The InChIKey is FNXAIVCZUNVAAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3N2O3/c10-9(11,12)6-2-1-4(7(13)14-17)3-5(6)8(15)16/h1-3,17H,(H2,13,14)(H,15,16).
What are the key properties of 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid?
5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid has a molecular weight of 248.16 g/mol, XLogP of 1.50, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-N'-hydroxycarbamimidoyl]-2-(trifluoromethyl)benzoic acid is sourced from PubChem (CID 138585092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).