C23H22N4O4 — CID 138585594
2-[4-(2-methoxyethoxy)phenyl]-4-[(1-methyl-2-oxo-3-pyridinyl)amino]phthalazin-1-one (PubChem CID 138585594) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-[4-(2-methoxyethoxy)phenyl]-4-[(1-methyl-2-oxo-3-pyridinyl)amino]phthalazin-1-one.
| Compound Name | 2-[4-(2-methoxyethoxy)phenyl]-4-[(1-methyl-2-oxo-3-pyridinyl)amino]phthalazin-1-one |
|---|---|
| PubChem CID | 138585594 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-[4-(2-methoxyethoxy)phenyl]-4-[(1-methyl-2-oxo-3-pyridinyl)amino]phthalazin-1-one |
| SMILES | COCCOc1ccc(-n2nc(Nc3cccn(C)c3=O)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H22N4O4/c1-26-13-5-8-20(23(26)29)24-21-18-6-3-4-7-19(18)22(28)27(25-21)16-9-11-17(12-10-16)31-15-14-30-2/h3-13H,14-15H2,1-2H3,(H,24,25) |
| InChIKey | XNOSTCIHSFAWEW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|