C11H10FN3S — CID 138585882
(5S,7S)-7-fluoro-5-phenyl-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione (PubChem CID 138585882) has the molecular formula C11H10FN3S and a molecular weight of 235.29 g/mol. Its IUPAC name is (5S,7S)-7-fluoro-5-phenyl-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione.
| Compound Name | (5S,7S)-7-fluoro-5-phenyl-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione |
|---|---|
| PubChem CID | 138585882 |
| Molecular Formula | C11H10FN3S |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | (5S,7S)-7-fluoro-5-phenyl-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione |
| SMILES | F[C@H]1C[C@@H](c2ccccc2)n2[nH]c(=S)nc21 |
| InChI | InChI=1S/C11H10FN3S/c12-8-6-9(7-4-2-1-3-5-7)15-10(8)13-11(16)14-15/h1-5,8-9H,6H2,(H,14,16)/t8-,9-/m0/s1 |
| InChIKey | AUSNPSCNTFMTBM-IUCAKERBSA-N |
| XLogP | 2.94 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|