C13H11F4N3O2S — CID 138585931
2,2,2-trifluoro-1-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]ethanesulfinic acid (PubChem CID 138585931) has the molecular formula C13H11F4N3O2S and a molecular weight of 349.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]ethanesulfinic acid.
| Compound Name | 2,2,2-trifluoro-1-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]ethanesulfinic acid |
|---|---|
| PubChem CID | 138585931 |
| Molecular Formula | C13H11F4N3O2S |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2,2,2-trifluoro-1-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]ethanesulfinic acid |
| SMILES | O=S(O)C(c1nc2n(n1)[C@H](c1ccccc1)C[C@@H]2F)C(F)(F)F |
| InChI | InChI=1S/C13H11F4N3O2S/c14-8-6-9(7-4-2-1-3-5-7)20-12(8)18-11(19-20)10(23(21)22)13(15,16)17/h1-5,8-10H,6H2,(H,21,22)/t8-,9-,10?/m0/s1 |
| InChIKey | PIDZZGOFTJNJNG-XMCUXHSSSA-N |
| XLogP | 3.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|