C11H7F4N3S — CID 138586101
(5S,7S)-7-fluoro-5-(2,3,6-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione (PubChem CID 138586101) has the molecular formula C11H7F4N3S and a molecular weight of 289.26 g/mol. Its IUPAC name is (5S,7S)-7-fluoro-5-(2,3,6-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione.
| Compound Name | (5S,7S)-7-fluoro-5-(2,3,6-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione |
|---|---|
| PubChem CID | 138586101 |
| Molecular Formula | C11H7F4N3S |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (5S,7S)-7-fluoro-5-(2,3,6-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione |
| SMILES | Fc1ccc(F)c([C@@H]2C[C@H](F)c3nc(=S)[nH]n32)c1F |
| InChI | InChI=1S/C11H7F4N3S/c12-4-1-2-5(13)9(15)8(4)7-3-6(14)10-16-11(19)17-18(7)10/h1-2,6-7H,3H2,(H,17,19)/t6-,7-/m0/s1 |
| InChIKey | RCFBMTIVTWDWDL-BQBZGAKWSA-N |
| XLogP | 3.36 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|