C23H28N6O — CID 138586722
1-(2-methylpropyl)-N-(7-pyrazin-2-ylquinazolin-2-yl)azepane-4-carboxamide (PubChem CID 138586722) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is 1-(2-methylpropyl)-N-(7-pyrazin-2-ylquinazolin-2-yl)azepane-4-carboxamide.
| Compound Name | 1-(2-methylpropyl)-N-(7-pyrazin-2-ylquinazolin-2-yl)azepane-4-carboxamide |
|---|---|
| PubChem CID | 138586722 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 1-(2-methylpropyl)-N-(7-pyrazin-2-ylquinazolin-2-yl)azepane-4-carboxamide |
| SMILES | CC(C)CN1CCCC(C(=O)Nc2ncc3ccc(-c4cnccn4)cc3n2)CC1 |
| InChI | InChI=1S/C23H28N6O/c1-16(2)15-29-10-3-4-17(7-11-29)22(30)28-23-26-13-19-6-5-18(12-20(19)27-23)21-14-24-8-9-25-21/h5-6,8-9,12-14,16-17H,3-4,7,10-11,15H2,1-2H3,(H,26,27,28,30) |
| InChIKey | RUKIITLYQDLRFL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |