C22H27N5O2 — CID 138587469
4-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-N-[6-(2-methyl-1,3-oxazol-5-yl)-2,7-naphthyridin-3-yl]cyclohexane-1-carboxamide (PubChem CID 138587469) has the molecular formula C22H27N5O2 and a molecular weight of 399.53 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-N-[6-(2-methyl-1,3-oxazol-5-yl)-2,7-naphthyridin-3-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-N-[6-(2-methyl-1,3-oxazol-5-yl)-2,7-naphthyridin-3-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 138587469 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-N-[6-(2-methyl-1,3-oxazol-5-yl)-2,7-naphthyridin-3-yl]cyclohexane-1-carboxamide |
| SMILES | [2H]C([2H])([2H])C(NC1CCC(C(=O)Nc2cc3cc(-c4cnc(C)o4)ncc3cn2)CC1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C22H27N5O2/c1-13(2)26-18-6-4-15(5-7-18)22(28)27-21-9-16-8-19(20-12-23-14(3)29-20)24-10-17(16)11-25-21/h8-13,15,18,26H,4-7H2,1-3H3,(H,25,27,28)/i1D3,2D3 |
| InChIKey | BTEYQZBOXSWHEV-WFGJKAKNSA-N |
| XLogP | 4.09 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |