C18H19N5OS — CID 138588116
1-methyl-N-[6-(1,2-thiazol-4-yl)cinnolin-3-yl]piperidine-4-carboxamide (PubChem CID 138588116) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is 1-methyl-N-[6-(1,2-thiazol-4-yl)cinnolin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-methyl-N-[6-(1,2-thiazol-4-yl)cinnolin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 138588116 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-methyl-N-[6-(1,2-thiazol-4-yl)cinnolin-3-yl]piperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)Nc2cc3cc(-c4cnsc4)ccc3nn2)CC1 |
| InChI | InChI=1S/C18H19N5OS/c1-23-6-4-12(5-7-23)18(24)20-17-9-14-8-13(15-10-19-25-11-15)2-3-16(14)21-22-17/h2-3,8-12H,4-7H2,1H3,(H,20,22,24) |
| InChIKey | OZKAGFHUZHQBDP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |