C20H21N9O — CID 138588367
N-[6-(1-methylpyrazol-4-yl)cinnolin-3-yl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 138588367) has the molecular formula C20H21N9O and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[6-(1-methylpyrazol-4-yl)cinnolin-3-yl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[6-(1-methylpyrazol-4-yl)cinnolin-3-yl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 138588367 |
| Molecular Formula | C20H21N9O |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[6-(1-methylpyrazol-4-yl)cinnolin-3-yl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cn1cc(-c2ccc3nnc(NC(=O)c4cn(C5CCNCC5)nn4)cc3c2)cn1 |
| InChI | InChI=1S/C20H21N9O/c1-28-11-15(10-22-28)13-2-3-17-14(8-13)9-19(26-24-17)23-20(30)18-12-29(27-25-18)16-4-6-21-7-5-16/h2-3,8-12,16,21H,4-7H2,1H3,(H,23,26,30) |
| InChIKey | KOSXLLTUBLUGLT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |