About 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide
1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide (PubChem CID 138589506) has the molecular formula C18H17FN4OS
and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide |
| PubChem CID | 138589506 |
| Molecular Formula | C18H17FN4OS |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ncc2ccc(-c3cncs3)cc2n1)C1(F)CCCCC1 |
| InChI | InChI=1S/C18H17FN4OS/c19-18(6-2-1-3-7-18)16(24)23-17-21-9-13-5-4-12(8-14(13)22-17)15-10-20-11-25-15/h4-5,8-11H,1-3,6-7H2,(H,21,22,23,24) |
| InChIKey | BKKIITMVJSLVIP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide?
The IUPAC name of 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide (CID 138589506) is 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide.
What is the SMILES notation for 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide?
The canonical SMILES for 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide is O=C(Nc1ncc2ccc(-c3cncs3)cc2n1)C1(F)CCCCC1.
What is the InChIKey of 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide?
The InChIKey is BKKIITMVJSLVIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN4OS/c19-18(6-2-1-3-7-18)16(24)23-17-21-9-13-5-4-12(8-14(13)22-17)15-10-20-11-25-15/h4-5,8-11H,1-3,6-7H2,(H,21,22,23,24).
What are the key properties of 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide?
1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide has a molecular weight of 356.43 g/mol, XLogP of 4.36, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]cyclohexane-1-carboxamide is sourced from PubChem (CID 138589506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).