About N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide
N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide (PubChem CID 138589552) has the molecular formula C17H17N5O2
and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide |
| PubChem CID | 138589552 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc2cc(-c3cnco3)cnc2cn1)C1CCNCC1 |
| InChI | InChI=1S/C17H17N5O2/c23-17(11-1-3-18-4-2-11)22-16-6-12-5-13(15-9-19-10-24-15)7-20-14(12)8-21-16/h5-11,18H,1-4H2,(H,21,22,23) |
| InChIKey | DTIGVCJSBWHRAE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide?
The IUPAC name of N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide (CID 138589552) is N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide.
What is the SMILES notation for N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide?
The canonical SMILES for N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide is O=C(Nc1cc2cc(-c3cnco3)cnc2cn1)C1CCNCC1.
What is the InChIKey of N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide?
The InChIKey is DTIGVCJSBWHRAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N5O2/c23-17(11-1-3-18-4-2-11)22-16-6-12-5-13(15-9-19-10-24-15)7-20-14(12)8-21-16/h5-11,18H,1-4H2,(H,21,22,23).
What are the key properties of N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide?
N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide has a molecular weight of 323.36 g/mol, XLogP of 2.22, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,3-oxazol-5-yl)-1,7-naphthyridin-6-yl]piperidine-4-carboxamide is sourced from PubChem (CID 138589552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).