C23H26N9O+ — CID 138589569
2-[4,4-bis(trideuteriomethyl)piperazin-4-ium-1-yl]-N-[6-(1-methyltriazol-4-yl)cinnolin-3-yl]pyridine-4-carboxamide (PubChem CID 138589569) has the molecular formula C23H26N9O+ and a molecular weight of 450.56 g/mol. Its IUPAC name is 2-[4,4-bis(trideuteriomethyl)piperazin-4-ium-1-yl]-N-[6-(1-methyltriazol-4-yl)cinnolin-3-yl]pyridine-4-carboxamide.
| Compound Name | 2-[4,4-bis(trideuteriomethyl)piperazin-4-ium-1-yl]-N-[6-(1-methyltriazol-4-yl)cinnolin-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 138589569 |
| Molecular Formula | C23H26N9O+ |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 2-[4,4-bis(trideuteriomethyl)piperazin-4-ium-1-yl]-N-[6-(1-methyltriazol-4-yl)cinnolin-3-yl]pyridine-4-carboxamide |
| SMILES | [2H]C([2H])([2H])[N+]1(C([2H])([2H])[2H])CCN(c2cc(C(=O)Nc3cc4cc(-c5cn(C)nn5)ccc4nn3)ccn2)CC1 |
| InChI | InChI=1S/C23H25N9O/c1-30-15-20(27-29-30)16-4-5-19-18(12-16)13-21(28-26-19)25-23(33)17-6-7-24-22(14-17)31-8-10-32(2,3)11-9-31/h4-7,12-15H,8-11H2,1-3H3/p+1/i2D3,3D3 |
| InChIKey | RRLZPWAGTQUQHO-XERRXZQWSA-O |
| XLogP | 1.97 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|