C19H18N8OS — CID 138589710
2-methyl-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,6-naphthyridin-7-yl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide (PubChem CID 138589710) has the molecular formula C19H18N8OS and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-methyl-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,6-naphthyridin-7-yl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | 2-methyl-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,6-naphthyridin-7-yl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 138589710 |
| Molecular Formula | C19H18N8OS |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-methyl-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,6-naphthyridin-7-yl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide |
| SMILES | Cc1cn2c(n1)CN(C(=O)Nc1cc3nc(-c4nnc(C)s4)ccc3cn1)CC2 |
| InChI | InChI=1S/C19H18N8OS/c1-11-9-26-5-6-27(10-17(26)21-11)19(28)23-16-7-15-13(8-20-16)3-4-14(22-15)18-25-24-12(2)29-18/h3-4,7-9H,5-6,10H2,1-2H3,(H,20,23,28) |
| InChIKey | ZUCMHZLVQVSDII-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |