C20H14FN5O — CID 138589953
N-[3-(5-amino-3-pyridinyl)-1,7-naphthyridin-6-yl]-4-fluorobenzamide (PubChem CID 138589953) has the molecular formula C20H14FN5O and a molecular weight of 359.36 g/mol. Its IUPAC name is N-[3-(5-amino-3-pyridinyl)-1,7-naphthyridin-6-yl]-4-fluorobenzamide.
| Compound Name | N-[3-(5-amino-3-pyridinyl)-1,7-naphthyridin-6-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 138589953 |
| Molecular Formula | C20H14FN5O |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-[3-(5-amino-3-pyridinyl)-1,7-naphthyridin-6-yl]-4-fluorobenzamide |
| SMILES | Nc1cncc(-c2cnc3cnc(NC(=O)c4ccc(F)cc4)cc3c2)c1 |
| InChI | InChI=1S/C20H14FN5O/c21-16-3-1-12(2-4-16)20(27)26-19-7-13-5-14(9-24-18(13)11-25-19)15-6-17(22)10-23-8-15/h1-11H,22H2,(H,25,26,27) |
| InChIKey | KFLOKFLRBHNGBK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |