C20H23N7O — CID 138590972
(3R)-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)-1,7-naphthyridin-6-yl]piperidine-3-carboxamide (PubChem CID 138590972) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is (3R)-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)-1,7-naphthyridin-6-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)-1,7-naphthyridin-6-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 138590972 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (3R)-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)-1,7-naphthyridin-6-yl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cc2cc(-c3cnc4n3CCNC4)cnc2cn1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C20H23N7O/c28-20(13-2-1-3-21-8-13)26-18-7-14-6-15(9-23-16(14)10-24-18)17-11-25-19-12-22-4-5-27(17)19/h6-7,9-11,13,21-22H,1-5,8,12H2,(H,24,26,28)/t13-/m1/s1 |
| InChIKey | ILDWAYFKTBHGHX-CYBMUJFWSA-N |
| XLogP | 1.53 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |