C22H28N6O2 — CID 138591450
4-(2-methoxyethylamino)-N-[3-(1-methylpyrazol-4-yl)-1,7-naphthyridin-6-yl]cyclohexane-1-carboxamide (PubChem CID 138591450) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 4-(2-methoxyethylamino)-N-[3-(1-methylpyrazol-4-yl)-1,7-naphthyridin-6-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(2-methoxyethylamino)-N-[3-(1-methylpyrazol-4-yl)-1,7-naphthyridin-6-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 138591450 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 4-(2-methoxyethylamino)-N-[3-(1-methylpyrazol-4-yl)-1,7-naphthyridin-6-yl]cyclohexane-1-carboxamide |
| SMILES | COCCNC1CCC(C(=O)Nc2cc3cc(-c4cnn(C)c4)cnc3cn2)CC1 |
| InChI | InChI=1S/C22H28N6O2/c1-28-14-18(12-26-28)17-9-16-10-21(25-13-20(16)24-11-17)27-22(29)15-3-5-19(6-4-15)23-7-8-30-2/h9-15,19,23H,3-8H2,1-2H3,(H,25,27,29) |
| InChIKey | GMHBORMLRPZMJR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|