C27H23Cl2N5O3 — CID 138592275
2-[2-[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]-7-azaspiro[3.5]non-2-en-7-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid (PubChem CID 138592275) has the molecular formula C27H23Cl2N5O3 and a molecular weight of 536.42 g/mol. Its IUPAC name is 2-[2-[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]-7-azaspiro[3.5]non-2-en-7-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid.
| Compound Name | 2-[2-[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]-7-azaspiro[3.5]non-2-en-7-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid |
|---|---|
| PubChem CID | 138592275 |
| Molecular Formula | C27H23Cl2N5O3 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 2-[2-[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]-7-azaspiro[3.5]non-2-en-7-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid |
| SMILES | O=C(O)c1ccn2nc(N3CCC4(C=C(c5c(-c6c(Cl)cccc6Cl)noc5C5CC5)C4)CC3)ncc12 |
| InChI | InChI=1S/C27H23Cl2N5O3/c28-18-2-1-3-19(29)22(18)23-21(24(37-32-23)15-4-5-15)16-12-27(13-16)7-10-33(11-8-27)26-30-14-20-17(25(35)36)6-9-34(20)31-26/h1-3,6,9,12,14-15H,4-5,7-8,10-11,13H2,(H,35,36) |
| InChIKey | TXSMUNYTYONBAF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |