About ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate
ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate (PubChem CID 138592378) has the molecular formula C13H14FN3O2
and a molecular weight of 263.27 g/mol. Its IUPAC name is ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate |
| PubChem CID | 138592378 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(C)c2c(nnn2C)c1F |
| InChI | InChI=1S/C13H14FN3O2/c1-4-19-10(18)6-5-9-7-8(2)13-12(11(9)14)15-16-17(13)3/h5-7H,4H2,1-3H3/b6-5+ |
| InChIKey | DQWRLZPPXAHJLE-AATRIKPKSA-N |
| XLogP | 1.99 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate?
The IUPAC name of ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate (CID 138592378) is ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate.
What is the SMILES notation for ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate?
The canonical SMILES for ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate is CCOC(=O)/C=C/c1cc(C)c2c(nnn2C)c1F.
What is the InChIKey of ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate?
The InChIKey is DQWRLZPPXAHJLE-AATRIKPKSA-N. The full InChI is InChI=1S/C13H14FN3O2/c1-4-19-10(18)6-5-9-7-8(2)13-12(11(9)14)15-16-17(13)3/h5-7H,4H2,1-3H3/b6-5+.
What are the key properties of ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate?
ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate has a molecular weight of 263.27 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-(4-fluoro-1,7-dimethylbenzotriazol-5-yl)prop-2-enoate is sourced from PubChem (CID 138592378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).