About 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol
1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol (PubChem CID 138592651) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol.
Molecular Properties
| Compound Name | 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol |
| PubChem CID | 138592651 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol |
| SMILES | CC(S)C1=CC2N=CC=CC2N1C |
| InChI | InChI=1S/C10H14N2S/c1-7(13)10-6-8-9(12(10)2)4-3-5-11-8/h3-9,13H,1-2H3 |
| InChIKey | IXHOXNWVIRFXSU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol?
The IUPAC name of 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol (CID 138592651) is 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol.
What is the SMILES notation for 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol?
The canonical SMILES for 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol is CC(S)C1=CC2N=CC=CC2N1C.
What is the InChIKey of 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol?
The InChIKey is IXHOXNWVIRFXSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c1-7(13)10-6-8-9(12(10)2)4-3-5-11-8/h3-9,13H,1-2H3.
What are the key properties of 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol?
1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol has a molecular weight of 194.30 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-3a,7a-dihydropyrrolo[3,2-b]pyridin-2-yl)ethanethiol is sourced from PubChem (CID 138592651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).