C35H46N2O4 — CID 138592758
(1S,2R,6R,14S,16R)-5-isoquinolin-7-yl-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine (PubChem CID 138592758) has the molecular formula C35H46N2O4 and a molecular weight of 558.76 g/mol. Its IUPAC name is (1S,2R,6R,14S,16R)-5-isoquinolin-7-yl-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine.
| Compound Name | (1S,2R,6R,14S,16R)-5-isoquinolin-7-yl-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine |
|---|---|
| PubChem CID | 138592758 |
| Molecular Formula | C35H46N2O4 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | (1S,2R,6R,14S,16R)-5-isoquinolin-7-yl-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine |
| SMILES | COCCOCCOCCN[C@H]1CCC2=CC3=CC[C@]4(C)C(c5ccc6ccncc6c5)CC[C@H]4[C@@]34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C35H46N2O4/c1-33-11-9-29-22-28-5-6-30(37-15-16-39-19-20-40-18-17-38-2)23-34(28)12-13-35(29,41-34)32(33)8-7-31(33)26-4-3-25-10-14-36-24-27(25)21-26/h3-4,9-10,14,21-22,24,30-32,37H,5-8,11-13,15-20,23H2,1-2H3/t30-,31?,32+,33+,34+,35+/m0/s1 |
| InChIKey | MHAAWDTYUCXSCZ-FBZLAOGWSA-N |
| XLogP | 6.11 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|