About N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide
N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide (PubChem CID 138593525) has the molecular formula C10H8BrF3N2O2S
and a molecular weight of 357.15 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide |
| PubChem CID | 138593525 |
| Molecular Formula | C10H8BrF3N2O2S |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N=S(=O)(c1ccc(Br)cn1)C1CC1)C(F)(F)F |
| InChI | InChI=1S/C10H8BrF3N2O2S/c11-6-1-4-8(15-5-6)19(18,7-2-3-7)16-9(17)10(12,13)14/h1,4-5,7H,2-3H2 |
| InChIKey | DCNHKRMFKAVGHE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide (CID 138593525) is N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide is O=C(N=S(=O)(c1ccc(Br)cn1)C1CC1)C(F)(F)F.
What is the InChIKey of N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide?
The InChIKey is DCNHKRMFKAVGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF3N2O2S/c11-6-1-4-8(15-5-6)19(18,7-2-3-7)16-9(17)10(12,13)14/h1,4-5,7H,2-3H2.
What are the key properties of N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide?
N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide has a molecular weight of 357.15 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-bromo-2-pyridinyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 138593525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).