About (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide
(4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide (PubChem CID 138593531) has the molecular formula C17H17Cl2N3O2
and a molecular weight of 366.25 g/mol. Its IUPAC name is (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide.
Molecular Properties
| Compound Name | (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide |
| PubChem CID | 138593531 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide |
| SMILES | CCO/N=C(\CCC(=O)Nc1ccccn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-2-24-22-15(12-6-7-13(18)14(19)11-12)8-9-17(23)21-16-5-3-4-10-20-16/h3-7,10-11H,2,8-9H2,1H3,(H,20,21,23)/b22-15+ |
| InChIKey | QHHIWKRQKWYWIB-PXLXIMEGSA-N |
| XLogP | 4.55 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide?
The IUPAC name of (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide (CID 138593531) is (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide.
What is the SMILES notation for (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide?
The canonical SMILES for (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide is CCO/N=C(\CCC(=O)Nc1ccccn1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide?
The InChIKey is QHHIWKRQKWYWIB-PXLXIMEGSA-N. The full InChI is InChI=1S/C17H17Cl2N3O2/c1-2-24-22-15(12-6-7-13(18)14(19)11-12)8-9-17(23)21-16-5-3-4-10-20-16/h3-7,10-11H,2,8-9H2,1H3,(H,20,21,23)/b22-15+.
What are the key properties of (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide?
(4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide has a molecular weight of 366.25 g/mol, XLogP of 4.55, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-(3,4-dichlorophenyl)-4-ethoxyimino-N-pyridin-2-ylbutanamide is sourced from PubChem (CID 138593531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).