C16H11NO3S — CID 138593696
6-methyl-5,5-dioxoindeno[1,2-c][1,2]benzothiazin-11-one (PubChem CID 138593696) has the molecular formula C16H11NO3S and a molecular weight of 297.33 g/mol. Its IUPAC name is 6-methyl-5,5-dioxoindeno[1,2-c][1,2]benzothiazin-11-one.
| Compound Name | 6-methyl-5,5-dioxoindeno[1,2-c][1,2]benzothiazin-11-one |
|---|---|
| PubChem CID | 138593696 |
| Molecular Formula | C16H11NO3S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 6-methyl-5,5-dioxoindeno[1,2-c][1,2]benzothiazin-11-one |
| SMILES | CN1C2=C(C(=O)c3ccccc32)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C16H11NO3S/c1-17-15-10-6-2-3-7-11(10)16(18)14(15)12-8-4-5-9-13(12)21(17,19)20/h2-9H,1H3 |
| InChIKey | CFAZSERJAGFKNX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|