C22H18N2O5S — CID 138593841
dimethyl 4-(7-cyano-1-benzothiophen-3-yl)-2-cyclopropyl-6-formyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 138593841) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is dimethyl 4-(7-cyano-1-benzothiophen-3-yl)-2-cyclopropyl-6-formyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(7-cyano-1-benzothiophen-3-yl)-2-cyclopropyl-6-formyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 138593841 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | dimethyl 4-(7-cyano-1-benzothiophen-3-yl)-2-cyclopropyl-6-formyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C=O)NC(C2CC2)=C(C(=O)OC)C1c1csc2c(C#N)cccc12 |
| InChI | InChI=1S/C22H18N2O5S/c1-28-21(26)17-15(9-25)24-19(11-6-7-11)18(22(27)29-2)16(17)14-10-30-20-12(8-23)4-3-5-13(14)20/h3-5,9-11,16,24H,6-7H2,1-2H3 |
| InChIKey | RSCVJHOGRGBHRR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|