C25H33ClN6O3 — CID 138594455
4-chloro-6-[2-(dimethylamino)ethoxy]-1-methyl-1'-(8-methyl-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-2-yl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 138594455) has the molecular formula C25H33ClN6O3 and a molecular weight of 501.03 g/mol. Its IUPAC name is 4-chloro-6-[2-(dimethylamino)ethoxy]-1-methyl-1'-(8-methyl-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-2-yl)spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 4-chloro-6-[2-(dimethylamino)ethoxy]-1-methyl-1'-(8-methyl-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-2-yl)spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 138594455 |
| Molecular Formula | C25H33ClN6O3 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 4-chloro-6-[2-(dimethylamino)ethoxy]-1-methyl-1'-(8-methyl-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-2-yl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CN(C)CCOc1cc(Cl)c2c(c1)N(C)C(=O)C21CCN(c2nc3c(c(=O)[nH]2)CCCN3C)CC1 |
| InChI | InChI=1S/C25H33ClN6O3/c1-29(2)12-13-35-16-14-18(26)20-19(15-16)31(4)23(34)25(20)7-10-32(11-8-25)24-27-21-17(22(33)28-24)6-5-9-30(21)3/h14-15H,5-13H2,1-4H3,(H,27,28,33) |
| InChIKey | SWRMEAIEIVBECE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |