C31H35FN6O3 — CID 138594575
4-fluoro-1'-(8-methyl-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-2-yl)-6-[4-(4-methylpiperazin-1-yl)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one (PubChem CID 138594575) has the molecular formula C31H35FN6O3 and a molecular weight of 558.66 g/mol. Its IUPAC name is 4-fluoro-1'-(8-methyl-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-2-yl)-6-[4-(4-methylpiperazin-1-yl)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one.
| Compound Name | 4-fluoro-1'-(8-methyl-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-2-yl)-6-[4-(4-methylpiperazin-1-yl)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 138594575 |
| Molecular Formula | C31H35FN6O3 |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 4-fluoro-1'-(8-methyl-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-2-yl)-6-[4-(4-methylpiperazin-1-yl)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one |
| SMILES | CN1CCN(c2ccc(-c3cc(F)c4c(c3)C(=O)OC43CCN(c4nc5c(c(=O)[nH]4)CCCN5C)CC3)cc2)CC1 |
| InChI | InChI=1S/C31H35FN6O3/c1-35-14-16-37(17-15-35)22-7-5-20(6-8-22)21-18-24-26(25(32)19-21)31(41-29(24)40)9-12-38(13-10-31)30-33-27-23(28(39)34-30)4-3-11-36(27)2/h5-8,18-19H,3-4,9-17H2,1-2H3,(H,33,34,39) |
| InChIKey | ZNSGEOABXRBQFW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |