C20H23FN4O — CID 138594964
2-(6-fluorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one (PubChem CID 138594964) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-(6-fluorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one.
| Compound Name | 2-(6-fluorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 138594964 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-(6-fluorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(N2CCC3(CC2)CNc2cc(F)ccc23)nc2c1CCCC2 |
| InChI | InChI=1S/C20H23FN4O/c21-13-5-6-15-17(11-13)22-12-20(15)7-9-25(10-8-20)19-23-16-4-2-1-3-14(16)18(26)24-19/h5-6,11,22H,1-4,7-10,12H2,(H,23,24,26) |
| InChIKey | KMMKOGNMTHXBIM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |