About bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide
bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide (PubChem CID 138595270) has the molecular formula C18H40N2S
and a molecular weight of 316.60 g/mol. Its IUPAC name is bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide.
Molecular Properties
| Compound Name | bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide |
| PubChem CID | 138595270 |
| Molecular Formula | C18H40N2S |
| Molecular Weight | 316.60 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide |
| SMILES | CCCC[N+]1(C)CCCC1.CCCC[N+]1(C)CCCC1.[S-2] |
| InChI | InChI=1S/2C9H20N.S/c2*1-3-4-7-10(2)8-5-6-9-10;/h2*3-9H2,1-2H3;/q2*+1;-2 |
| InChIKey | JKGSIDHMKPAWJT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide?
The IUPAC name of bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide (CID 138595270) is bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide.
What is the SMILES notation for bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide?
The canonical SMILES for bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide is CCCC[N+]1(C)CCCC1.CCCC[N+]1(C)CCCC1.[S-2].
What is the InChIKey of bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide?
The InChIKey is JKGSIDHMKPAWJT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H20N.S/c2*1-3-4-7-10(2)8-5-6-9-10;/h2*3-9H2,1-2H3;/q2*+1;-2.
What are the key properties of bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide?
bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide has a molecular weight of 316.60 g/mol, XLogP of 4.05, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-butyl-1-methylpyrrolidin-1-ium);sulfide is sourced from PubChem (CID 138595270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).