C20H26N4O3 — CID 138595501
2-methoxyethyl 4-[[(1S,3R)-3-(2-cyanoethyl)cyclohexyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 138595501) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[(1S,3R)-3-(2-cyanoethyl)cyclohexyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | 2-methoxyethyl 4-[[(1S,3R)-3-(2-cyanoethyl)cyclohexyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 138595501 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-methoxyethyl 4-[[(1S,3R)-3-(2-cyanoethyl)cyclohexyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | COCCOC(=O)c1cnc2[nH]ccc2c1N[C@H]1CCC[C@H](CCC#N)C1 |
| InChI | InChI=1S/C20H26N4O3/c1-26-10-11-27-20(25)17-13-23-19-16(7-9-22-19)18(17)24-15-6-2-4-14(12-15)5-3-8-21/h7,9,13-15H,2-6,10-12H2,1H3,(H2,22,23,24)/t14-,15+/m1/s1 |
| InChIKey | ZLJGDOFLMDGAKL-CABCVRRESA-N |
| XLogP | 3.64 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|