About 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid
4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid (PubChem CID 138595711) has the molecular formula C23H24F2N2O3
and a molecular weight of 414.45 g/mol. Its IUPAC name is 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid |
| PubChem CID | 138595711 |
| Molecular Formula | C23H24F2N2O3 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1CCC(F)(F)CC1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H24F2N2O3/c1-14-11-20(30-2)18(17-7-9-26-21(14)17)13-27-10-8-23(24,25)12-19(27)15-3-5-16(6-4-15)22(28)29/h3-7,9,11,19,26H,8,10,12-13H2,1-2H3,(H,28,29) |
| InChIKey | YVAYFCCNMGZSIT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid?
The IUPAC name of 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid (CID 138595711) is 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid.
What is the SMILES notation for 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid?
The canonical SMILES for 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid is COc1cc(C)c2[nH]ccc2c1CN1CCC(F)(F)CC1c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid?
The InChIKey is YVAYFCCNMGZSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24F2N2O3/c1-14-11-20(30-2)18(17-7-9-26-21(14)17)13-27-10-8-23(24,25)12-19(27)15-3-5-16(6-4-15)22(28)29/h3-7,9,11,19,26H,8,10,12-13H2,1-2H3,(H,28,29).
What are the key properties of 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid?
4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid has a molecular weight of 414.45 g/mol, XLogP of 5.16, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,4-difluoro-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid is sourced from PubChem (CID 138595711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).