C28H37N2O6P — CID 138595743
4-[[2-(4-diethoxyphosphorylphenyl)-4-methylpiperidin-1-yl]methyl]-5-methoxy-7-methylindole-1-carboxylic acid (PubChem CID 138595743) has the molecular formula C28H37N2O6P and a molecular weight of 528.59 g/mol. Its IUPAC name is 4-[[2-(4-diethoxyphosphorylphenyl)-4-methylpiperidin-1-yl]methyl]-5-methoxy-7-methylindole-1-carboxylic acid.
| Compound Name | 4-[[2-(4-diethoxyphosphorylphenyl)-4-methylpiperidin-1-yl]methyl]-5-methoxy-7-methylindole-1-carboxylic acid |
|---|---|
| PubChem CID | 138595743 |
| Molecular Formula | C28H37N2O6P |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 4-[[2-(4-diethoxyphosphorylphenyl)-4-methylpiperidin-1-yl]methyl]-5-methoxy-7-methylindole-1-carboxylic acid |
| SMILES | CCOP(=O)(OCC)c1ccc(C2CC(C)CCN2Cc2c(OC)cc(C)c3c2ccn3C(=O)O)cc1 |
| InChI | InChI=1S/C28H37N2O6P/c1-6-35-37(33,36-7-2)22-10-8-21(9-11-22)25-16-19(3)12-14-29(25)18-24-23-13-15-30(28(31)32)27(23)20(4)17-26(24)34-5/h8-11,13,15,17,19,25H,6-7,12,14,16,18H2,1-5H3,(H,31,32) |
| InChIKey | KGPKOPLFIUDPJR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|