C15H14F2N2O3 — CID 138596061
(2R,4S)-4-fluoro-2-[(6-fluoro-2-formyl-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylic acid (PubChem CID 138596061) has the molecular formula C15H14F2N2O3 and a molecular weight of 308.28 g/mol. Its IUPAC name is (2R,4S)-4-fluoro-2-[(6-fluoro-2-formyl-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R,4S)-4-fluoro-2-[(6-fluoro-2-formyl-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 138596061 |
| Molecular Formula | C15H14F2N2O3 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2R,4S)-4-fluoro-2-[(6-fluoro-2-formyl-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=Cc1[nH]c2cc(F)ccc2c1C[C@@H]1C[C@H](F)CN1C(=O)O |
| InChI | InChI=1S/C15H14F2N2O3/c16-8-1-2-11-12(14(7-20)18-13(11)4-8)5-10-3-9(17)6-19(10)15(21)22/h1-2,4,7,9-10,18H,3,5-6H2,(H,21,22)/t9-,10-/m0/s1 |
| InChIKey | NZKTYSOPLYYYKE-UWVGGRQHSA-N |
| XLogP | 2.75 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|