C18H23FN2O3S — CID 138597088
tert-butyl 4-[(2R)-7-amino-5-fluoro-2-sulfanyl-2,3-dihydro-1-benzofuran-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 138597088) has the molecular formula C18H23FN2O3S and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl 4-[(2R)-7-amino-5-fluoro-2-sulfanyl-2,3-dihydro-1-benzofuran-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2R)-7-amino-5-fluoro-2-sulfanyl-2,3-dihydro-1-benzofuran-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 138597088 |
| Molecular Formula | C18H23FN2O3S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | tert-butyl 4-[(2R)-7-amino-5-fluoro-2-sulfanyl-2,3-dihydro-1-benzofuran-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2c(F)cc(N)c3c2C[C@@H](S)O3)CC1 |
| InChI | InChI=1S/C18H23FN2O3S/c1-18(2,3)24-17(22)21-6-4-10(5-7-21)15-11-8-14(25)23-16(11)13(20)9-12(15)19/h4,9,14,25H,5-8,20H2,1-3H3/t14-/m1/s1 |
| InChIKey | FXWRHXKNMHPARV-CQSZACIVSA-N |
| XLogP | 3.62 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|