C16H18F3NO4 — CID 138597318
4-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde;2,2,2-trifluoroacetic acid (PubChem CID 138597318) has the molecular formula C16H18F3NO4 and a molecular weight of 345.32 g/mol. Its IUPAC name is 4-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138597318 |
| Molecular Formula | C16H18F3NO4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 4-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=Cc1ccc(OC2C[C@H]3CC[C@@H](C2)N3)cc1 |
| InChI | InChI=1S/C14H17NO2.C2HF3O2/c16-9-10-1-5-13(6-2-10)17-14-7-11-3-4-12(8-14)15-11;3-2(4,5)1(6)7/h1-2,5-6,9,11-12,14-15H,3-4,7-8H2;(H,6,7)/t11-,12+,14?; |
| InChIKey | YVFGQBPRIWDBCU-IEVOETTMSA-N |
| XLogP | 2.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|