[2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid

C8H15N3O3 — CID 138597727

IUPAC[2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid
SMILESN/C(=N/O)C1CCCCC1NC(=O)O
InChIInChI=1S/C8H15N3O3/c9-7(11-14)5-3-1-2-4-6(5)10-8(12)13/h5-6,10,14H,1-4H2,(H2,9,11)(H,12,13)
InChIKeyGOKVMUQEANRRLI-UHFFFAOYSA-N
MW201.23 g/mol
LogP0.56
Rot. Bonds2

About [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid

[2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid (PubChem CID 138597727) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid.

Molecular Properties

Compound Name[2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid
PubChem CID138597727
Molecular FormulaC8H15N3O3
Molecular Weight201.23 g/mol
Exact Mass201.11
IUPAC Name[2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid
SMILESN/C(=N/O)C1CCCCC1NC(=O)O
InChIInChI=1S/C8H15N3O3/c9-7(11-14)5-3-1-2-4-6(5)10-8(12)13/h5-6,10,14H,1-4H2,(H2,9,11)(H,12,13)
InChIKeyGOKVMUQEANRRLI-UHFFFAOYSA-N
XLogP0.56
TPSA107.94 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.23
LogP ≤ 50.56
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid?
The IUPAC name of [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid (CID 138597727) is [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid.
What is the SMILES notation for [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid?
The canonical SMILES for [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid is N/C(=N/O)C1CCCCC1NC(=O)O.
What is the InChIKey of [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid?
The InChIKey is GOKVMUQEANRRLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O3/c9-7(11-14)5-3-1-2-4-6(5)10-8(12)13/h5-6,10,14H,1-4H2,(H2,9,11)(H,12,13).
What are the key properties of [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid?
[2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid has a molecular weight of 201.23 g/mol, XLogP of 0.56, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]carbamic acid is sourced from PubChem (CID 138597727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).