About 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide
1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide (PubChem CID 138598402) has the molecular formula C18H25ClN4O3
and a molecular weight of 380.88 g/mol. Its IUPAC name is 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide |
| PubChem CID | 138598402 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide |
| SMILES | CCOC(C#Cc1cnc(Cl)nc1NC1(C(N)=O)CCCCC1)OCC |
| InChI | InChI=1S/C18H25ClN4O3/c1-3-25-14(26-4-2)9-8-13-12-21-17(19)22-15(13)23-18(16(20)24)10-6-5-7-11-18/h12,14H,3-7,10-11H2,1-2H3,(H2,20,24)(H,21,22,23) |
| InChIKey | RIPNPGABYBFQQU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide?
The IUPAC name of 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide (CID 138598402) is 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide.
What is the SMILES notation for 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide?
The canonical SMILES for 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide is CCOC(C#Cc1cnc(Cl)nc1NC1(C(N)=O)CCCCC1)OCC.
What is the InChIKey of 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide?
The InChIKey is RIPNPGABYBFQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25ClN4O3/c1-3-25-14(26-4-2)9-8-13-12-21-17(19)22-15(13)23-18(16(20)24)10-6-5-7-11-18/h12,14H,3-7,10-11H2,1-2H3,(H2,20,24)(H,21,22,23).
What are the key properties of 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide?
1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide has a molecular weight of 380.88 g/mol, XLogP of 2.48, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxamide is sourced from PubChem (CID 138598402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).