C10H18O2 — CID 138598662
(8aR)-2-methoxy-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene (PubChem CID 138598662) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (8aR)-2-methoxy-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene.
| Compound Name | (8aR)-2-methoxy-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene |
|---|---|
| PubChem CID | 138598662 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (8aR)-2-methoxy-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene |
| SMILES | COC1CCC2CCCC[C@H]2O1 |
| InChI | InChI=1S/C10H18O2/c1-11-10-7-6-8-4-2-3-5-9(8)12-10/h8-10H,2-7H2,1H3/t8?,9-,10?/m1/s1 |
| InChIKey | OCHCLYSTSPSMKY-HWOCKDDLSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |