About [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite
[6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite (PubChem CID 138598755) has the molecular formula C9H12INO2
and a molecular weight of 293.10 g/mol. Its IUPAC name is [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite.
Molecular Properties
| Compound Name | [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite |
| PubChem CID | 138598755 |
| Molecular Formula | C9H12INO2 |
| Molecular Weight | 293.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite |
| SMILES | COC1=CC=C(OI)CC(CN)=C1 |
| InChI | InChI=1S/C9H12INO2/c1-12-8-2-3-9(13-10)5-7(4-8)6-11/h2-4H,5-6,11H2,1H3 |
| InChIKey | HJXQUNDYVCBING-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite?
The IUPAC name of [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite (CID 138598755) is [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite.
What is the SMILES notation for [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite?
The canonical SMILES for [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite is COC1=CC=C(OI)CC(CN)=C1.
What is the InChIKey of [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite?
The InChIKey is HJXQUNDYVCBING-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12INO2/c1-12-8-2-3-9(13-10)5-7(4-8)6-11/h2-4H,5-6,11H2,1H3.
What are the key properties of [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite?
[6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite has a molecular weight of 293.10 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(aminomethyl)-4-methoxycyclohepta-1,3,5-trien-1-yl] hypoiodite is sourced from PubChem (CID 138598755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).