C12H22O5 — CID 138598859
[(1R,2R)-1-acetyloxy-1-(2-methylbutan-2-yloxy)propan-2-yl] acetate (PubChem CID 138598859) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is [(1R,2R)-1-acetyloxy-1-(2-methylbutan-2-yloxy)propan-2-yl] acetate.
| Compound Name | [(1R,2R)-1-acetyloxy-1-(2-methylbutan-2-yloxy)propan-2-yl] acetate |
|---|---|
| PubChem CID | 138598859 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | [(1R,2R)-1-acetyloxy-1-(2-methylbutan-2-yloxy)propan-2-yl] acetate |
| SMILES | CCC(C)(C)O[C@H](OC(C)=O)[C@@H](C)OC(C)=O |
| InChI | InChI=1S/C12H22O5/c1-7-12(5,6)17-11(16-10(4)14)8(2)15-9(3)13/h8,11H,7H2,1-6H3/t8-,11+/m1/s1 |
| InChIKey | HVRGDVZOPXTMFQ-KCJUWKMLSA-N |
| XLogP | 2.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|