About (4Z)-3-methyliminohepta-4,6-diene-1-thiol
(4Z)-3-methyliminohepta-4,6-diene-1-thiol (PubChem CID 138599228) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is (4Z)-3-methyliminohepta-4,6-diene-1-thiol.
Molecular Properties
| Compound Name | (4Z)-3-methyliminohepta-4,6-diene-1-thiol |
| PubChem CID | 138599228 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (4Z)-3-methyliminohepta-4,6-diene-1-thiol |
| SMILES | C=C/C=C\C(CCS)=N\C |
| InChI | InChI=1S/C8H13NS/c1-3-4-5-8(9-2)6-7-10/h3-5,10H,1,6-7H2,2H3/b5-4-,9-8- |
| InChIKey | JOGZDGXPWCTDGO-WPAMCMATSA-N |
| XLogP | 2.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-3-methyliminohepta-4,6-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-3-methyliminohepta-4,6-diene-1-thiol?
The IUPAC name of (4Z)-3-methyliminohepta-4,6-diene-1-thiol (CID 138599228) is (4Z)-3-methyliminohepta-4,6-diene-1-thiol.
What is the SMILES notation for (4Z)-3-methyliminohepta-4,6-diene-1-thiol?
The canonical SMILES for (4Z)-3-methyliminohepta-4,6-diene-1-thiol is C=C/C=C\C(CCS)=N\C.
What is the InChIKey of (4Z)-3-methyliminohepta-4,6-diene-1-thiol?
The InChIKey is JOGZDGXPWCTDGO-WPAMCMATSA-N. The full InChI is InChI=1S/C8H13NS/c1-3-4-5-8(9-2)6-7-10/h3-5,10H,1,6-7H2,2H3/b5-4-,9-8-.
What are the key properties of (4Z)-3-methyliminohepta-4,6-diene-1-thiol?
(4Z)-3-methyliminohepta-4,6-diene-1-thiol has a molecular weight of 155.27 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-3-methyliminohepta-4,6-diene-1-thiol is sourced from PubChem (CID 138599228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).