C19H25N5O8 — CID 138599318
2-[[2-[2-[[(Z)-but-2-enoyl]-formylamino]ethylamino]-2-oxoethyl]-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid (PubChem CID 138599318) has the molecular formula C19H25N5O8 and a molecular weight of 451.44 g/mol. Its IUPAC name is 2-[[2-[2-[[(Z)-but-2-enoyl]-formylamino]ethylamino]-2-oxoethyl]-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-[[(Z)-but-2-enoyl]-formylamino]ethylamino]-2-oxoethyl]-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 138599318 |
| Molecular Formula | C19H25N5O8 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[[2-[2-[[(Z)-but-2-enoyl]-formylamino]ethylamino]-2-oxoethyl]-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid |
| SMILES | C/C=C\C(=O)N(C=O)CCNC(=O)CN(CC(=O)O)CC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H25N5O8/c1-2-3-16(28)23(13-25)8-6-20-14(26)10-22(12-19(31)32)11-15(27)21-7-9-24-17(29)4-5-18(24)30/h2-5,13H,6-12H2,1H3,(H,20,26)(H,21,27)(H,31,32)/b3-2- |
| InChIKey | ZBKARXHHRYYUSN-IHWYPQMZSA-N |
| XLogP | -2.91 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|