C16H18O4 — CID 138599590
(3E,5E,8E,10E)-3-ethenyl-12-hydroxy-10-methoxytrideca-3,5,8,10,12-pentaene-2,7-dione (PubChem CID 138599590) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (3E,5E,8E,10E)-3-ethenyl-12-hydroxy-10-methoxytrideca-3,5,8,10,12-pentaene-2,7-dione.
| Compound Name | (3E,5E,8E,10E)-3-ethenyl-12-hydroxy-10-methoxytrideca-3,5,8,10,12-pentaene-2,7-dione |
|---|---|
| PubChem CID | 138599590 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (3E,5E,8E,10E)-3-ethenyl-12-hydroxy-10-methoxytrideca-3,5,8,10,12-pentaene-2,7-dione |
| SMILES | C=C/C(=C\C=C\C(=O)/C=C/C(=C\C(=C)O)OC)C(C)=O |
| InChI | InChI=1S/C16H18O4/c1-5-14(13(3)18)7-6-8-15(19)9-10-16(20-4)11-12(2)17/h5-11,17H,1-2H2,3-4H3/b8-6+,10-9+,14-7+,16-11+ |
| InChIKey | CMTARHGXCAZTJR-FIUNTRHJSA-N |
| XLogP | 2.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|