C61H32F12N4S — CID 138599690
2,7-bis[2,4-bis(trifluoromethyl)phenyl]-9-[4-dibenzothiophen-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 138599690) has the molecular formula C61H32F12N4S and a molecular weight of 1081.00 g/mol. Its IUPAC name is 2,7-bis[2,4-bis(trifluoromethyl)phenyl]-9-[4-dibenzothiophen-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 2,7-bis[2,4-bis(trifluoromethyl)phenyl]-9-[4-dibenzothiophen-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 138599690 |
| Molecular Formula | C61H32F12N4S |
| Molecular Weight | 1081.00 g/mol |
| Exact Mass | 1080.22 |
| IUPAC Name | 2,7-bis[2,4-bis(trifluoromethyl)phenyl]-9-[4-dibenzothiophen-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | FC(F)(F)c1ccc(-c2ccc3c4ccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc4n(-c4ccc(-c5cccc6sc7ccccc7c56)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C61H32F12N4S/c62-58(63,64)38-21-25-40(47(31-38)60(68,69)70)36-18-23-43-44-24-19-37(41-26-22-39(59(65,66)67)32-48(41)61(71,72)73)30-51(44)77(50(43)29-36)49-27-20-35(42-15-9-17-53-54(42)45-14-7-8-16-52(45)78-53)28-46(49)57-75-55(33-10-3-1-4-11-33)74-56(76-57)34-12-5-2-6-13-34/h1-32H |
| InChIKey | RNRUGHIYQHQLGL-UHFFFAOYSA-N |
| XLogP | 19.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.00 |
| LogP ≤ 5 | 19.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |