About (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine
(2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine (PubChem CID 138599694) has the molecular formula C7H8F3N
and a molecular weight of 163.14 g/mol. Its IUPAC name is (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine.
Analyze (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine?
The IUPAC name of (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine (CID 138599694) is (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine.
What is the SMILES notation for (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine?
The canonical SMILES for (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine is NCC1C(F)=CC(F)=CC1F.
What is the InChIKey of (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine?
The InChIKey is IUFSQSKIQUELCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N/c8-4-1-6(9)5(3-11)7(10)2-4/h1-2,5-6H,3,11H2.
What are the key properties of (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine?
(2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine has a molecular weight of 163.14 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,6-trifluorocyclohexa-2,4-dien-1-yl)methanamine is sourced from PubChem (CID 138599694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).