About 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid
4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 138599791) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid |
| PubChem CID | 138599791 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CNCC1=CC=C(C(=O)O)CC1 |
| InChI | InChI=1S/C9H13NO2/c1-10-6-7-2-4-8(5-3-7)9(11)12/h2,4,10H,3,5-6H2,1H3,(H,11,12) |
| InChIKey | UYFCNIGALIWFON-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid (CID 138599791) is 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid is CNCC1=CC=C(C(=O)O)CC1.
What is the InChIKey of 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is UYFCNIGALIWFON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-10-6-7-2-4-8(5-3-7)9(11)12/h2,4,10H,3,5-6H2,1H3,(H,11,12).
What are the key properties of 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid?
4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 167.21 g/mol, XLogP of 0.94, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylaminomethyl)cyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 138599791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).