C26H34N4O3 — CID 138600207
N-hydroxy-3-methyl-4-[[6-(2-morpholin-4-ylethyl)-1,2,3,4-tetrahydropyrido[3,4-b]indol-9-yl]methyl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 138600207) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-hydroxy-3-methyl-4-[[6-(2-morpholin-4-ylethyl)-1,2,3,4-tetrahydropyrido[3,4-b]indol-9-yl]methyl]cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | N-hydroxy-3-methyl-4-[[6-(2-morpholin-4-ylethyl)-1,2,3,4-tetrahydropyrido[3,4-b]indol-9-yl]methyl]cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 138600207 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | N-hydroxy-3-methyl-4-[[6-(2-morpholin-4-ylethyl)-1,2,3,4-tetrahydropyrido[3,4-b]indol-9-yl]methyl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC1C=C(C(=O)NO)C=CC1Cn1c2c(c3cc(CCN4CCOCC4)ccc31)CCNC2 |
| InChI | InChI=1S/C26H34N4O3/c1-18-14-20(26(31)28-32)3-4-21(18)17-30-24-5-2-19(7-9-29-10-12-33-13-11-29)15-23(24)22-6-8-27-16-25(22)30/h2-5,14-15,18,21,27,32H,6-13,16-17H2,1H3,(H,28,31) |
| InChIKey | AOJLHGSJIKQDDB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|