C16H19F3N4O3 — CID 138601512
N-[(1S)-5-amino-1-[5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]pentyl]acetamide (PubChem CID 138601512) has the molecular formula C16H19F3N4O3 and a molecular weight of 372.35 g/mol. Its IUPAC name is N-[(1S)-5-amino-1-[5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]pentyl]acetamide.
| Compound Name | N-[(1S)-5-amino-1-[5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 138601512 |
| Molecular Formula | C16H19F3N4O3 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-[(1S)-5-amino-1-[5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]pentyl]acetamide |
| SMILES | CC(=O)N[C@@H](CCCCN)c1nnc(-c2cccc(OC(F)(F)F)c2)o1 |
| InChI | InChI=1S/C16H19F3N4O3/c1-10(24)21-13(7-2-3-8-20)15-23-22-14(25-15)11-5-4-6-12(9-11)26-16(17,18)19/h4-6,9,13H,2-3,7-8,20H2,1H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | OXIOORQGNDXQJT-ZDUSSCGKSA-N |
| XLogP | 2.94 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|