C11H21F2NO — CID 138601828
3,3-difluoro-1-[3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine (PubChem CID 138601828) has the molecular formula C11H21F2NO and a molecular weight of 221.29 g/mol. Its IUPAC name is 3,3-difluoro-1-[3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine.
| Compound Name | 3,3-difluoro-1-[3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine |
|---|---|
| PubChem CID | 138601828 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 3,3-difluoro-1-[3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine |
| SMILES | CC(C)(C)OCCCN1CCC(F)(F)C1 |
| InChI | InChI=1S/C11H21F2NO/c1-10(2,3)15-8-4-6-14-7-5-11(12,13)9-14/h4-9H2,1-3H3 |
| InChIKey | NTMNGOLHLVAGFO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|